C17H23Cl2NO — CID 104690675
1-(2,4-dichlorophenyl)-2-(2-ethylazepan-1-yl)propan-1-one (PubChem CID 104690675) has the molecular formula C17H23Cl2NO and a molecular weight of 328.28 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(2-ethylazepan-1-yl)propan-1-one.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(2-ethylazepan-1-yl)propan-1-one |
|---|---|
| PubChem CID | 104690675 |
| Molecular Formula | C17H23Cl2NO |
| Molecular Weight | 328.28 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(2-ethylazepan-1-yl)propan-1-one |
| SMILES | CCC1CCCCCN1C(C)C(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H23Cl2NO/c1-3-14-7-5-4-6-10-20(14)12(2)17(21)15-9-8-13(18)11-16(15)19/h8-9,11-12,14H,3-7,10H2,1-2H3 |
| InChIKey | UTNJVMNEFJWIGU-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.28 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |