C14H18Cl2N2O — CID 62037868
2-(3-aminopiperidin-1-yl)-1-(2,4-dichlorophenyl)propan-1-one (PubChem CID 62037868) has the molecular formula C14H18Cl2N2O and a molecular weight of 301.22 g/mol. Its IUPAC name is 2-(3-aminopiperidin-1-yl)-1-(2,4-dichlorophenyl)propan-1-one.
| Compound Name | 2-(3-aminopiperidin-1-yl)-1-(2,4-dichlorophenyl)propan-1-one |
|---|---|
| PubChem CID | 62037868 |
| Molecular Formula | C14H18Cl2N2O |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 2-(3-aminopiperidin-1-yl)-1-(2,4-dichlorophenyl)propan-1-one |
| SMILES | CC(C(=O)c1ccc(Cl)cc1Cl)N1CCCC(N)C1 |
| InChI | InChI=1S/C14H18Cl2N2O/c1-9(18-6-2-3-11(17)8-18)14(19)12-5-4-10(15)7-13(12)16/h4-5,7,9,11H,2-3,6,8,17H2,1H3 |
| InChIKey | KYOZQZWOFOUMHF-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |