C13H12Cl2N2O — CID 60871958
1-(2,4-dichlorophenyl)-2-(4-methylpyrazol-1-yl)propan-1-one (PubChem CID 60871958) has the molecular formula C13H12Cl2N2O and a molecular weight of 283.16 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-2-(4-methylpyrazol-1-yl)propan-1-one.
| Compound Name | 1-(2,4-dichlorophenyl)-2-(4-methylpyrazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 60871958 |
| Molecular Formula | C13H12Cl2N2O |
| Molecular Weight | 283.16 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-2-(4-methylpyrazol-1-yl)propan-1-one |
| SMILES | Cc1cnn(C(C)C(=O)c2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C13H12Cl2N2O/c1-8-6-16-17(7-8)9(2)13(18)11-4-3-10(14)5-12(11)15/h3-7,9H,1-2H3 |
| InChIKey | ZENCDGAHMZLOIK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.16 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |