C16H17BFNO2 — CID 10469151
2-fluoro-3,3-dimethyl-2,4-diphenyl-1-oxa-3-azonia-2-boranuidacyclopent-4-en-5-ol (PubChem CID 10469151) has the molecular formula C16H17BFNO2 and a molecular weight of 285.13 g/mol. Its IUPAC name is 2-fluoro-3,3-dimethyl-2,4-diphenyl-1-oxa-3-azonia-2-boranuidacyclopent-4-en-5-ol.
| Compound Name | 2-fluoro-3,3-dimethyl-2,4-diphenyl-1-oxa-3-azonia-2-boranuidacyclopent-4-en-5-ol |
|---|---|
| PubChem CID | 10469151 |
| Molecular Formula | C16H17BFNO2 |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 2-fluoro-3,3-dimethyl-2,4-diphenyl-1-oxa-3-azonia-2-boranuidacyclopent-4-en-5-ol |
| SMILES | C[N+]1(C)C(c2ccccc2)=C(O)O[B-]1(F)c1ccccc1 |
| InChI | InChI=1S/C16H17BFNO2/c1-19(2)15(13-9-5-3-6-10-13)16(20)21-17(19,18)14-11-7-4-8-12-14/h3-12,20H,1-2H3 |
| InChIKey | SPLWRFNFASHELF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|