C20H20BNO4 — CID 123526308
(4Z)-2-(2-phenylethenyl)-6-(1-phenylethyl)-1,3,6,2-dioxazaborocine-4,8-diol (PubChem CID 123526308) has the molecular formula C20H20BNO4 and a molecular weight of 349.20 g/mol. Its IUPAC name is (4Z)-2-(2-phenylethenyl)-6-(1-phenylethyl)-1,3,6,2-dioxazaborocine-4,8-diol.
| Compound Name | (4Z)-2-(2-phenylethenyl)-6-(1-phenylethyl)-1,3,6,2-dioxazaborocine-4,8-diol |
|---|---|
| PubChem CID | 123526308 |
| Molecular Formula | C20H20BNO4 |
| Molecular Weight | 349.20 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (4Z)-2-(2-phenylethenyl)-6-(1-phenylethyl)-1,3,6,2-dioxazaborocine-4,8-diol |
| SMILES | CC(c1ccccc1)N1C=C(O)OB(C=Cc2ccccc2)O/C(O)=C\1 |
| InChI | InChI=1S/C20H20BNO4/c1-16(18-10-6-3-7-11-18)22-14-19(23)25-21(26-20(24)15-22)13-12-17-8-4-2-5-9-17/h2-16,23-24H,1H3/b13-12?,19-14-,20-15? |
| InChIKey | UJLYUMBFUHEVIK-GALHMBCCSA-N |
| XLogP | 4.55 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.20 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|