C21H28BNO2 — CID 146170285
(1S)-N,N-dimethyl-1-phenyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine (PubChem CID 146170285) has the molecular formula C21H28BNO2 and a molecular weight of 337.27 g/mol. Its IUPAC name is (1S)-N,N-dimethyl-1-phenyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine.
| Compound Name | (1S)-N,N-dimethyl-1-phenyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 146170285 |
| Molecular Formula | C21H28BNO2 |
| Molecular Weight | 337.27 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | (1S)-N,N-dimethyl-1-phenyl-1-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine |
| SMILES | CN(C)[C@@H](c1ccccc1)c1ccccc1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C21H28BNO2/c1-20(2)21(3,4)25-22(24-20)18-15-11-10-14-17(18)19(23(5)6)16-12-8-7-9-13-16/h7-15,19H,1-6H3/t19-/m0/s1 |
| InChIKey | FNMJSBLZYRDBQQ-IBGZPJMESA-N |
| XLogP | 3.64 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.27 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|