C14H20ClNO4S — CID 104692762
5-(2-ethylazepane-1-carbonyl)-2-methylfuran-3-sulfonyl chloride (PubChem CID 104692762) has the molecular formula C14H20ClNO4S and a molecular weight of 333.84 g/mol. Its IUPAC name is 5-(2-ethylazepane-1-carbonyl)-2-methylfuran-3-sulfonyl chloride.
| Compound Name | 5-(2-ethylazepane-1-carbonyl)-2-methylfuran-3-sulfonyl chloride |
|---|---|
| PubChem CID | 104692762 |
| Molecular Formula | C14H20ClNO4S |
| Molecular Weight | 333.84 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | 5-(2-ethylazepane-1-carbonyl)-2-methylfuran-3-sulfonyl chloride |
| SMILES | CCC1CCCCCN1C(=O)c1cc(S(=O)(=O)Cl)c(C)o1 |
| InChI | InChI=1S/C14H20ClNO4S/c1-3-11-7-5-4-6-8-16(11)14(17)12-9-13(10(2)20-12)21(15,18)19/h9,11H,3-8H2,1-2H3 |
| InChIKey | PZYJQUIXRKTHRF-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 67.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.84 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |