C14H17BrClNO3S — CID 65372117
5-bromo-3-(2-ethylpyrrolidine-1-carbonyl)-2-methylbenzenesulfonyl chloride (PubChem CID 65372117) has the molecular formula C14H17BrClNO3S and a molecular weight of 394.72 g/mol. Its IUPAC name is 5-bromo-3-(2-ethylpyrrolidine-1-carbonyl)-2-methylbenzenesulfonyl chloride.
| Compound Name | 5-bromo-3-(2-ethylpyrrolidine-1-carbonyl)-2-methylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 65372117 |
| Molecular Formula | C14H17BrClNO3S |
| Molecular Weight | 394.72 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | 5-bromo-3-(2-ethylpyrrolidine-1-carbonyl)-2-methylbenzenesulfonyl chloride |
| SMILES | CCC1CCCN1C(=O)c1cc(Br)cc(S(=O)(=O)Cl)c1C |
| InChI | InChI=1S/C14H17BrClNO3S/c1-3-11-5-4-6-17(11)14(18)12-7-10(15)8-13(9(12)2)21(16,19)20/h7-8,11H,3-6H2,1-2H3 |
| InChIKey | FHCUTKOEZQWAHG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |