C13H19N3OS — CID 104694267
2-(2-methylpyrazol-3-yl)-N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]ethanamine (PubChem CID 104694267) has the molecular formula C13H19N3OS and a molecular weight of 265.38 g/mol. Its IUPAC name is 2-(2-methylpyrazol-3-yl)-N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]ethanamine.
| Compound Name | 2-(2-methylpyrazol-3-yl)-N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 104694267 |
| Molecular Formula | C13H19N3OS |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 2-(2-methylpyrazol-3-yl)-N-[[5-(methylsulfanylmethyl)furan-2-yl]methyl]ethanamine |
| SMILES | CSCc1ccc(CNCCc2ccnn2C)o1 |
| InChI | InChI=1S/C13H19N3OS/c1-16-11(6-8-15-16)5-7-14-9-12-3-4-13(17-12)10-18-2/h3-4,6,8,14H,5,7,9-10H2,1-2H3 |
| InChIKey | VWJBAQNZTREIDV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|