C14H19N3O — CID 104694398
N-[(4-methoxyphenyl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine (PubChem CID 104694398) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 104694398 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-(2-methylpyrazol-3-yl)ethanamine |
| SMILES | COc1ccc(CNCCc2ccnn2C)cc1 |
| InChI | InChI=1S/C14H19N3O/c1-17-13(8-10-16-17)7-9-15-11-12-3-5-14(18-2)6-4-12/h3-6,8,10,15H,7,9,11H2,1-2H3 |
| InChIKey | PZLFKBJYEFIWKT-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|