C16H21N3 — CID 104694435
N-(2,3-dihydro-1H-inden-5-ylmethyl)-2-(2-methylpyrazol-3-yl)ethanamine (PubChem CID 104694435) has the molecular formula C16H21N3 and a molecular weight of 255.36 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-ylmethyl)-2-(2-methylpyrazol-3-yl)ethanamine.
| Compound Name | N-(2,3-dihydro-1H-inden-5-ylmethyl)-2-(2-methylpyrazol-3-yl)ethanamine |
|---|---|
| PubChem CID | 104694435 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-ylmethyl)-2-(2-methylpyrazol-3-yl)ethanamine |
| SMILES | Cn1nccc1CCNCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H21N3/c1-19-16(8-10-18-19)7-9-17-12-13-5-6-14-3-2-4-15(14)11-13/h5-6,8,10-11,17H,2-4,7,9,12H2,1H3 |
| InChIKey | ZAVKRXQKQBAVQK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|