C15H24O6 — CID 10470074
[(4aR,5S,7aS)-1,3-diethoxy-5-hydroxy-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-7-yl]methyl acetate (PubChem CID 10470074) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is [(4aR,5S,7aS)-1,3-diethoxy-5-hydroxy-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-7-yl]methyl acetate.
| Compound Name | [(4aR,5S,7aS)-1,3-diethoxy-5-hydroxy-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-7-yl]methyl acetate |
|---|---|
| PubChem CID | 10470074 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | [(4aR,5S,7aS)-1,3-diethoxy-5-hydroxy-1,3,4,4a,5,7a-hexahydrocyclopenta[c]pyran-7-yl]methyl acetate |
| SMILES | CCOC1C[C@H]2[C@H](O)C=C(COC(C)=O)[C@H]2C(OCC)O1 |
| InChI | InChI=1S/C15H24O6/c1-4-18-13-7-11-12(17)6-10(8-20-9(3)16)14(11)15(21-13)19-5-2/h6,11-15,17H,4-5,7-8H2,1-3H3/t11-,12+,13?,14+,15?/m0/s1 |
| InChIKey | DCLSOGLTIZQRDM-HTXFPXQUSA-N |
| XLogP | 1.23 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|