C11H15ClF3NO2 — CID 104701059
N-[1-(2-chloroacetyl)-4-methylcyclohexyl]-2,2,2-trifluoroacetamide (PubChem CID 104701059) has the molecular formula C11H15ClF3NO2 and a molecular weight of 285.69 g/mol. Its IUPAC name is N-[1-(2-chloroacetyl)-4-methylcyclohexyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[1-(2-chloroacetyl)-4-methylcyclohexyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 104701059 |
| Molecular Formula | C11H15ClF3NO2 |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | N-[1-(2-chloroacetyl)-4-methylcyclohexyl]-2,2,2-trifluoroacetamide |
| SMILES | CC1CCC(NC(=O)C(F)(F)F)(C(=O)CCl)CC1 |
| InChI | InChI=1S/C11H15ClF3NO2/c1-7-2-4-10(5-3-7,8(17)6-12)16-9(18)11(13,14)15/h7H,2-6H2,1H3,(H,16,18) |
| InChIKey | MXFUGPPSJVBHSO-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|