C12H17ClF3NO2 — CID 104701808
N-[[1-(2-chloroacetyl)-4-methylcyclohexyl]methyl]-2,2,2-trifluoroacetamide (PubChem CID 104701808) has the molecular formula C12H17ClF3NO2 and a molecular weight of 299.72 g/mol. Its IUPAC name is N-[[1-(2-chloroacetyl)-4-methylcyclohexyl]methyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[[1-(2-chloroacetyl)-4-methylcyclohexyl]methyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 104701808 |
| Molecular Formula | C12H17ClF3NO2 |
| Molecular Weight | 299.72 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | N-[[1-(2-chloroacetyl)-4-methylcyclohexyl]methyl]-2,2,2-trifluoroacetamide |
| SMILES | CC1CCC(CNC(=O)C(F)(F)F)(C(=O)CCl)CC1 |
| InChI | InChI=1S/C12H17ClF3NO2/c1-8-2-4-11(5-3-8,9(18)6-13)7-17-10(19)12(14,15)16/h8H,2-7H2,1H3,(H,17,19) |
| InChIKey | WPXWSDOHGXJVFL-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.72 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|