C17H29NO3 — CID 115440979
1-[(3-cyclopentylpropanoylamino)methyl]-4-methylcyclohexane-1-carboxylic acid (PubChem CID 115440979) has the molecular formula C17H29NO3 and a molecular weight of 295.42 g/mol. Its IUPAC name is 1-[(3-cyclopentylpropanoylamino)methyl]-4-methylcyclohexane-1-carboxylic acid.
| Compound Name | 1-[(3-cyclopentylpropanoylamino)methyl]-4-methylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 115440979 |
| Molecular Formula | C17H29NO3 |
| Molecular Weight | 295.42 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 1-[(3-cyclopentylpropanoylamino)methyl]-4-methylcyclohexane-1-carboxylic acid |
| SMILES | CC1CCC(CNC(=O)CCC2CCCC2)(C(=O)O)CC1 |
| InChI | InChI=1S/C17H29NO3/c1-13-8-10-17(11-9-13,16(20)21)12-18-15(19)7-6-14-4-2-3-5-14/h13-14H,2-12H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | GKDHADXSKRWKIR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.42 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |