C17H31NO2 — CID 62527693
3-cyclohexyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]propanamide (PubChem CID 62527693) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 3-cyclohexyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]propanamide |
|---|---|
| PubChem CID | 62527693 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 3-cyclohexyl-N-[1-(hydroxymethyl)-4-methylcyclohexyl]propanamide |
| SMILES | CC1CCC(CO)(NC(=O)CCC2CCCCC2)CC1 |
| InChI | InChI=1S/C17H31NO2/c1-14-9-11-17(13-19,12-10-14)18-16(20)8-7-15-5-3-2-4-6-15/h14-15,19H,2-13H2,1H3,(H,18,20) |
| InChIKey | YEDDEWHLSBVKNY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |