C16H29NO2 — CID 62519861
3-cyclohexyl-N-[1-(hydroxymethyl)cyclohexyl]propanamide (PubChem CID 62519861) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is 3-cyclohexyl-N-[1-(hydroxymethyl)cyclohexyl]propanamide.
| Compound Name | 3-cyclohexyl-N-[1-(hydroxymethyl)cyclohexyl]propanamide |
|---|---|
| PubChem CID | 62519861 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 3-cyclohexyl-N-[1-(hydroxymethyl)cyclohexyl]propanamide |
| SMILES | O=C(CCC1CCCCC1)NC1(CO)CCCCC1 |
| InChI | InChI=1S/C16H29NO2/c18-13-16(11-5-2-6-12-16)17-15(19)10-9-14-7-3-1-4-8-14/h14,18H,1-13H2,(H,17,19) |
| InChIKey | CCFAECIGPXRUNK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |