C10H16BrNO3 — CID 104701922
methyl N-[2-(2-bromoacetyl)-2-methylcyclopentyl]carbamate (PubChem CID 104701922) has the molecular formula C10H16BrNO3 and a molecular weight of 278.15 g/mol. Its IUPAC name is methyl N-[2-(2-bromoacetyl)-2-methylcyclopentyl]carbamate.
| Compound Name | methyl N-[2-(2-bromoacetyl)-2-methylcyclopentyl]carbamate |
|---|---|
| PubChem CID | 104701922 |
| Molecular Formula | C10H16BrNO3 |
| Molecular Weight | 278.15 g/mol |
| Exact Mass | 277.03 |
| IUPAC Name | methyl N-[2-(2-bromoacetyl)-2-methylcyclopentyl]carbamate |
| SMILES | COC(=O)NC1CCCC1(C)C(=O)CBr |
| InChI | InChI=1S/C10H16BrNO3/c1-10(8(13)6-11)5-3-4-7(10)12-9(14)15-2/h7H,3-6H2,1-2H3,(H,12,14) |
| InChIKey | IAFUJUQZDDXMSO-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.15 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|