C16H16BrClN2O — CID 104702034
4-N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-chloro-5-methylbenzene-1,4-diamine (PubChem CID 104702034) has the molecular formula C16H16BrClN2O and a molecular weight of 367.67 g/mol. Its IUPAC name is 4-N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-chloro-5-methylbenzene-1,4-diamine.
| Compound Name | 4-N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-chloro-5-methylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 104702034 |
| Molecular Formula | C16H16BrClN2O |
| Molecular Weight | 367.67 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 4-N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2-chloro-5-methylbenzene-1,4-diamine |
| SMILES | Cc1cc(N)c(Cl)cc1NCc1cc(Br)cc2c1OCC2 |
| InChI | InChI=1S/C16H16BrClN2O/c1-9-4-14(19)13(18)7-15(9)20-8-11-6-12(17)5-10-2-3-21-16(10)11/h4-7,20H,2-3,8,19H2,1H3 |
| InChIKey | VNACVBJKALTGFT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.67 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|