C15H13BrCl2N2O — CID 106890755
1-N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2,6-dichlorobenzene-1,4-diamine (PubChem CID 106890755) has the molecular formula C15H13BrCl2N2O and a molecular weight of 388.09 g/mol. Its IUPAC name is 1-N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2,6-dichlorobenzene-1,4-diamine.
| Compound Name | 1-N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2,6-dichlorobenzene-1,4-diamine |
|---|---|
| PubChem CID | 106890755 |
| Molecular Formula | C15H13BrCl2N2O |
| Molecular Weight | 388.09 g/mol |
| Exact Mass | 385.96 |
| IUPAC Name | 1-N-[(5-bromo-2,3-dihydro-1-benzofuran-7-yl)methyl]-2,6-dichlorobenzene-1,4-diamine |
| SMILES | Nc1cc(Cl)c(NCc2cc(Br)cc3c2OCC3)c(Cl)c1 |
| InChI | InChI=1S/C15H13BrCl2N2O/c16-10-3-8-1-2-21-15(8)9(4-10)7-20-14-12(17)5-11(19)6-13(14)18/h3-6,20H,1-2,7,19H2 |
| InChIKey | KLUXUHGQNLNKQG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.09 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|