C15H12F3NO — CID 104703413
[5-(2,4,5-trifluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]methanamine (PubChem CID 104703413) has the molecular formula C15H12F3NO and a molecular weight of 279.26 g/mol. Its IUPAC name is [5-(2,4,5-trifluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]methanamine.
| Compound Name | [5-(2,4,5-trifluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]methanamine |
|---|---|
| PubChem CID | 104703413 |
| Molecular Formula | C15H12F3NO |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | [5-(2,4,5-trifluorophenyl)-2,3-dihydro-1-benzofuran-7-yl]methanamine |
| SMILES | NCc1cc(-c2cc(F)c(F)cc2F)cc2c1OCC2 |
| InChI | InChI=1S/C15H12F3NO/c16-12-6-14(18)13(17)5-11(12)9-3-8-1-2-20-15(8)10(4-9)7-19/h3-6H,1-2,7,19H2 |
| InChIKey | NHBIVZFFUREWGK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|