C9H17F3N2O3 — CID 104705190
2,2,2-trifluoroethyl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate (PubChem CID 104705190) has the molecular formula C9H17F3N2O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate.
| Compound Name | 2,2,2-trifluoroethyl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 104705190 |
| Molecular Formula | C9H17F3N2O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 2,2,2-trifluoroethyl N-[2-[2-(dimethylamino)ethoxy]ethyl]carbamate |
| SMILES | CN(C)CCOCCNC(=O)OCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O3/c1-14(2)4-6-16-5-3-13-8(15)17-7-9(10,11)12/h3-7H2,1-2H3,(H,13,15) |
| InChIKey | NWJNNRMHZFYSAA-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|