C17H28O3Si — CID 10470547
ethyl (2S,3aS)-6-[tert-butyl(dimethyl)silyl]-5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate (PubChem CID 10470547) has the molecular formula C17H28O3Si and a molecular weight of 308.49 g/mol. Its IUPAC name is ethyl (2S,3aS)-6-[tert-butyl(dimethyl)silyl]-5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate.
| Compound Name | ethyl (2S,3aS)-6-[tert-butyl(dimethyl)silyl]-5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate |
|---|---|
| PubChem CID | 10470547 |
| Molecular Formula | C17H28O3Si |
| Molecular Weight | 308.49 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | ethyl (2S,3aS)-6-[tert-butyl(dimethyl)silyl]-5-oxo-2,3,3a,4-tetrahydro-1H-pentalene-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC2=C([Si](C)(C)C(C)(C)C)C(=O)C[C@@H]2C1 |
| InChI | InChI=1S/C17H28O3Si/c1-7-20-16(19)12-8-11-10-14(18)15(13(11)9-12)21(5,6)17(2,3)4/h11-12H,7-10H2,1-6H3/t11-,12-/m0/s1 |
| InChIKey | YGLBNTBCFCSYNU-RYUDHWBXSA-N |
| XLogP | 3.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|