C21H34O5Si — CID 11315407
dimethyl 5-oxo-6-tri(propan-2-yl)silyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate (PubChem CID 11315407) has the molecular formula C21H34O5Si and a molecular weight of 394.58 g/mol. Its IUPAC name is dimethyl 5-oxo-6-tri(propan-2-yl)silyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate.
| Compound Name | dimethyl 5-oxo-6-tri(propan-2-yl)silyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 11315407 |
| Molecular Formula | C21H34O5Si |
| Molecular Weight | 394.58 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | dimethyl 5-oxo-6-tri(propan-2-yl)silyl-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C([Si](C(C)C)(C(C)C)C(C)C)C(=O)CC2C1 |
| InChI | InChI=1S/C21H34O5Si/c1-12(2)27(13(3)4,14(5)6)18-16-11-21(19(23)25-7,20(24)26-8)10-15(16)9-17(18)22/h12-15H,9-11H2,1-8H3 |
| InChIKey | KMOYTMNCZGNSGA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.58 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|