C12H13IO5 — CID 12013179
dimethyl 6-iodo-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate (PubChem CID 12013179) has the molecular formula C12H13IO5 and a molecular weight of 364.14 g/mol. Its IUPAC name is dimethyl 6-iodo-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate.
| Compound Name | dimethyl 6-iodo-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 12013179 |
| Molecular Formula | C12H13IO5 |
| Molecular Weight | 364.14 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | dimethyl 6-iodo-5-oxo-1,3,3a,4-tetrahydropentalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(I)C(=O)CC2C1 |
| InChI | InChI=1S/C12H13IO5/c1-17-10(15)12(11(16)18-2)4-6-3-8(14)9(13)7(6)5-12/h6H,3-5H2,1-2H3 |
| InChIKey | QHBHPEUBZBWTIG-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.14 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|