About CID 10470856
CID 10470856 (PubChem CID 10470856) has the molecular formula C10H22NO6P2
and a molecular weight of 314.24 g/mol.
Molecular Properties
| Compound Name | CID 10470856 |
| PubChem CID | 10470856 |
| Molecular Formula | C10H22NO6P2 |
| Molecular Weight | 314.24 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | — |
| SMILES | CCOP(C/C(=N\[O])P(=O)(OCC)OCC)OCC |
| InChI | InChI=1S/C10H22NO6P2/c1-5-14-18(15-6-2)9-10(11-12)19(13,16-7-3)17-8-4/h5-9H2,1-4H3/b11-10+ |
| InChIKey | RNSRPYVHLBUYCI-ZHACJKMWSA-N |
| XLogP | 3.38 |
| TPSA | 86.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 10470856 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10470856?
The IUPAC name of CID 10470856 (CID 10470856) is not available.
What is the SMILES notation for CID 10470856?
The canonical SMILES for CID 10470856 is CCOP(C/C(=N\[O])P(=O)(OCC)OCC)OCC.
What is the InChIKey of CID 10470856?
The InChIKey is RNSRPYVHLBUYCI-ZHACJKMWSA-N. The full InChI is InChI=1S/C10H22NO6P2/c1-5-14-18(15-6-2)9-10(11-12)19(13,16-7-3)17-8-4/h5-9H2,1-4H3/b11-10+.
What are the key properties of CID 10470856?
CID 10470856 has a molecular weight of 314.24 g/mol, XLogP of 3.38, 11 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10470856 is sourced from PubChem (CID 10470856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).