C11H17N5O2S — CID 104709882
N-[1-(cyanomethyl)piperidin-4-yl]-2-methylpyrazole-3-sulfonamide (PubChem CID 104709882) has the molecular formula C11H17N5O2S and a molecular weight of 283.36 g/mol. Its IUPAC name is N-[1-(cyanomethyl)piperidin-4-yl]-2-methylpyrazole-3-sulfonamide.
| Compound Name | N-[1-(cyanomethyl)piperidin-4-yl]-2-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 104709882 |
| Molecular Formula | C11H17N5O2S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | N-[1-(cyanomethyl)piperidin-4-yl]-2-methylpyrazole-3-sulfonamide |
| SMILES | Cn1nccc1S(=O)(=O)NC1CCN(CC#N)CC1 |
| InChI | InChI=1S/C11H17N5O2S/c1-15-11(2-6-13-15)19(17,18)14-10-3-7-16(8-4-10)9-5-12/h2,6,10,14H,3-4,7-9H2,1H3 |
| InChIKey | SCYYRNACBAGSOH-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|