C9H15N3O2S — CID 104709770
N-cyclopentyl-2-methylpyrazole-3-sulfonamide (PubChem CID 104709770) has the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. Its IUPAC name is N-cyclopentyl-2-methylpyrazole-3-sulfonamide.
| Compound Name | N-cyclopentyl-2-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 104709770 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | N-cyclopentyl-2-methylpyrazole-3-sulfonamide |
| SMILES | Cn1nccc1S(=O)(=O)NC1CCCC1 |
| InChI | InChI=1S/C9H15N3O2S/c1-12-9(6-7-10-12)15(13,14)11-8-4-2-3-5-8/h6-8,11H,2-5H2,1H3 |
| InChIKey | OHIFQTVNOAOSNI-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |