C10H16N4O3S — CID 104710290
N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2-methylpyrazole-3-sulfonamide (PubChem CID 104710290) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2-methylpyrazole-3-sulfonamide.
| Compound Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2-methylpyrazole-3-sulfonamide |
|---|---|
| PubChem CID | 104710290 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | N-(6-amino-2-oxabicyclo[3.2.0]heptan-7-yl)-2-methylpyrazole-3-sulfonamide |
| SMILES | Cn1nccc1S(=O)(=O)NC1C(N)C2CCOC21 |
| InChI | InChI=1S/C10H16N4O3S/c1-14-7(2-4-12-14)18(15,16)13-9-8(11)6-3-5-17-10(6)9/h2,4,6,8-10,13H,3,5,11H2,1H3 |
| InChIKey | LRMJKOMDWITAFR-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |