C13H23N3O4S — CID 104710386
tert-butyl (2S)-3-methyl-2-[(2-methylpyrazol-3-yl)sulfonylamino]butanoate (PubChem CID 104710386) has the molecular formula C13H23N3O4S and a molecular weight of 317.41 g/mol. Its IUPAC name is tert-butyl (2S)-3-methyl-2-[(2-methylpyrazol-3-yl)sulfonylamino]butanoate.
| Compound Name | tert-butyl (2S)-3-methyl-2-[(2-methylpyrazol-3-yl)sulfonylamino]butanoate |
|---|---|
| PubChem CID | 104710386 |
| Molecular Formula | C13H23N3O4S |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | tert-butyl (2S)-3-methyl-2-[(2-methylpyrazol-3-yl)sulfonylamino]butanoate |
| SMILES | CC(C)[C@H](NS(=O)(=O)c1ccnn1C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H23N3O4S/c1-9(2)11(12(17)20-13(3,4)5)15-21(18,19)10-7-8-14-16(10)6/h7-9,11,15H,1-6H3/t11-/m0/s1 |
| InChIKey | LGINWWITTQPDTQ-NSHDSACASA-N |
| XLogP | 1.06 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |