C8H20N4O — CID 104711122
3-amino-2-[(4-methylpiperazin-1-yl)amino]propan-1-ol (PubChem CID 104711122) has the molecular formula C8H20N4O and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-amino-2-[(4-methylpiperazin-1-yl)amino]propan-1-ol.
| Compound Name | 3-amino-2-[(4-methylpiperazin-1-yl)amino]propan-1-ol |
|---|---|
| PubChem CID | 104711122 |
| Molecular Formula | C8H20N4O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | 3-amino-2-[(4-methylpiperazin-1-yl)amino]propan-1-ol |
| SMILES | CN1CCN(NC(CN)CO)CC1 |
| InChI | InChI=1S/C8H20N4O/c1-11-2-4-12(5-3-11)10-8(6-9)7-13/h8,10,13H,2-7,9H2,1H3 |
| InChIKey | HZJQILYRLXUHGA-UHFFFAOYSA-N |
| XLogP | -1.94 |
| TPSA | 64.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | -1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |