C9H22N4 — CID 83011257
2-N-(4-methylpiperazin-1-yl)butane-1,2-diamine (PubChem CID 83011257) has the molecular formula C9H22N4 and a molecular weight of 186.30 g/mol. Its IUPAC name is 2-N-(4-methylpiperazin-1-yl)butane-1,2-diamine.
| Compound Name | 2-N-(4-methylpiperazin-1-yl)butane-1,2-diamine |
|---|---|
| PubChem CID | 83011257 |
| Molecular Formula | C9H22N4 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.18 |
| IUPAC Name | 2-N-(4-methylpiperazin-1-yl)butane-1,2-diamine |
| SMILES | CCC(CN)NN1CCN(C)CC1 |
| InChI | InChI=1S/C9H22N4/c1-3-9(8-10)11-13-6-4-12(2)5-7-13/h9,11H,3-8,10H2,1-2H3 |
| InChIKey | FGQLTKAEODBWIN-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |