C9H11FN2O2 — CID 104711180
2-(3-fluoroanilino)-3-hydroxypropanamide (PubChem CID 104711180) has the molecular formula C9H11FN2O2 and a molecular weight of 198.20 g/mol. Its IUPAC name is 2-(3-fluoroanilino)-3-hydroxypropanamide.
| Compound Name | 2-(3-fluoroanilino)-3-hydroxypropanamide |
|---|---|
| PubChem CID | 104711180 |
| Molecular Formula | C9H11FN2O2 |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 2-(3-fluoroanilino)-3-hydroxypropanamide |
| SMILES | NC(=O)C(CO)Nc1cccc(F)c1 |
| InChI | InChI=1S/C9H11FN2O2/c10-6-2-1-3-7(4-6)12-8(5-13)9(11)14/h1-4,8,12-13H,5H2,(H2,11,14) |
| InChIKey | QITVWJPYIDBQSL-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |