C17H26FN3O3 — CID 112753975
tert-butyl N-[5-amino-4-(3-fluoroanilino)-2-methyl-5-oxopentan-2-yl]carbamate (PubChem CID 112753975) has the molecular formula C17H26FN3O3 and a molecular weight of 339.41 g/mol. Its IUPAC name is tert-butyl N-[5-amino-4-(3-fluoroanilino)-2-methyl-5-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-amino-4-(3-fluoroanilino)-2-methyl-5-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 112753975 |
| Molecular Formula | C17H26FN3O3 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | tert-butyl N-[5-amino-4-(3-fluoroanilino)-2-methyl-5-oxopentan-2-yl]carbamate |
| SMILES | CC(C)(CC(Nc1cccc(F)c1)C(N)=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26FN3O3/c1-16(2,3)24-15(23)21-17(4,5)10-13(14(19)22)20-12-8-6-7-11(18)9-12/h6-9,13,20H,10H2,1-5H3,(H2,19,22)(H,21,23) |
| InChIKey | XYSZPMBMLUCEAQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |