C19H16N2O3 — CID 10471239
2-[2-[(3-methylquinolin-4-yl)amino]-2-oxoethyl]benzoic acid (PubChem CID 10471239) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 2-[2-[(3-methylquinolin-4-yl)amino]-2-oxoethyl]benzoic acid.
| Compound Name | 2-[2-[(3-methylquinolin-4-yl)amino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 10471239 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 2-[2-[(3-methylquinolin-4-yl)amino]-2-oxoethyl]benzoic acid |
| SMILES | Cc1cnc2ccccc2c1NC(=O)Cc1ccccc1C(=O)O |
| InChI | InChI=1S/C19H16N2O3/c1-12-11-20-16-9-5-4-8-15(16)18(12)21-17(22)10-13-6-2-3-7-14(13)19(23)24/h2-9,11H,10H2,1H3,(H,23,24)(H,20,21,22) |
| InChIKey | WGOXTQJNBPSQSE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |