C14H17N3O4 — CID 104713080
3-(5-cyano-2-nitroanilino)-4,4-dimethylpentanoic acid (PubChem CID 104713080) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 3-(5-cyano-2-nitroanilino)-4,4-dimethylpentanoic acid.
| Compound Name | 3-(5-cyano-2-nitroanilino)-4,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 104713080 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 3-(5-cyano-2-nitroanilino)-4,4-dimethylpentanoic acid |
| SMILES | CC(C)(C)C(CC(=O)O)Nc1cc(C#N)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17N3O4/c1-14(2,3)12(7-13(18)19)16-10-6-9(8-15)4-5-11(10)17(20)21/h4-6,12,16H,7H2,1-3H3,(H,18,19) |
| InChIKey | CPANKDVZGPKOSC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 116.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|