C16H23N3O5 — CID 156771557
methyl (3S)-4,4-dimethyl-3-[5-(methylcarbamoyl)-2-nitroanilino]pentanoate (PubChem CID 156771557) has the molecular formula C16H23N3O5 and a molecular weight of 337.38 g/mol. Its IUPAC name is methyl (3S)-4,4-dimethyl-3-[5-(methylcarbamoyl)-2-nitroanilino]pentanoate.
| Compound Name | methyl (3S)-4,4-dimethyl-3-[5-(methylcarbamoyl)-2-nitroanilino]pentanoate |
|---|---|
| PubChem CID | 156771557 |
| Molecular Formula | C16H23N3O5 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | methyl (3S)-4,4-dimethyl-3-[5-(methylcarbamoyl)-2-nitroanilino]pentanoate |
| SMILES | CNC(=O)c1ccc([N+](=O)[O-])c(N[C@@H](CC(=O)OC)C(C)(C)C)c1 |
| InChI | InChI=1S/C16H23N3O5/c1-16(2,3)13(9-14(20)24-5)18-11-8-10(15(21)17-4)6-7-12(11)19(22)23/h6-8,13,18H,9H2,1-5H3,(H,17,21)/t13-/m0/s1 |
| InChIKey | VGPRNHHZXPUUQQ-ZDUSSCGKSA-N |
| XLogP | 2.34 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|