C16H22ClN3O5 — CID 156771501
methyl (3R)-3-[5-chloro-4-(methylcarbamoyl)-2-nitroanilino]-4,4-dimethylpentanoate (PubChem CID 156771501) has the molecular formula C16H22ClN3O5 and a molecular weight of 371.82 g/mol. Its IUPAC name is methyl (3R)-3-[5-chloro-4-(methylcarbamoyl)-2-nitroanilino]-4,4-dimethylpentanoate.
| Compound Name | methyl (3R)-3-[5-chloro-4-(methylcarbamoyl)-2-nitroanilino]-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 156771501 |
| Molecular Formula | C16H22ClN3O5 |
| Molecular Weight | 371.82 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | methyl (3R)-3-[5-chloro-4-(methylcarbamoyl)-2-nitroanilino]-4,4-dimethylpentanoate |
| SMILES | CNC(=O)c1cc([N+](=O)[O-])c(N[C@H](CC(=O)OC)C(C)(C)C)cc1Cl |
| InChI | InChI=1S/C16H22ClN3O5/c1-16(2,3)13(8-14(21)25-5)19-11-7-10(17)9(15(22)18-4)6-12(11)20(23)24/h6-7,13,19H,8H2,1-5H3,(H,18,22)/t13-/m1/s1 |
| InChIKey | JPONAYIMWVECMO-CYBMUJFWSA-N |
| XLogP | 3.00 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.82 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|