C9H8ClN3O5 — CID 88924576
2-chloro-N-ethyl-4,5-dinitrobenzamide (PubChem CID 88924576) has the molecular formula C9H8ClN3O5 and a molecular weight of 273.63 g/mol. Its IUPAC name is 2-chloro-N-ethyl-4,5-dinitrobenzamide.
| Compound Name | 2-chloro-N-ethyl-4,5-dinitrobenzamide |
|---|---|
| PubChem CID | 88924576 |
| Molecular Formula | C9H8ClN3O5 |
| Molecular Weight | 273.63 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | 2-chloro-N-ethyl-4,5-dinitrobenzamide |
| SMILES | CCNC(=O)c1cc([N+](=O)[O-])c([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C9H8ClN3O5/c1-2-11-9(14)5-3-7(12(15)16)8(13(17)18)4-6(5)10/h3-4H,2H2,1H3,(H,11,14) |
| InChIKey | TYBQIGVZQFCZHJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.63 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|