C16H25N3O3 — CID 175140630
methyl 3-[2-amino-4-(methylcarbamoyl)anilino]-4,4-dimethylpentanoate (PubChem CID 175140630) has the molecular formula C16H25N3O3 and a molecular weight of 307.39 g/mol. Its IUPAC name is methyl 3-[2-amino-4-(methylcarbamoyl)anilino]-4,4-dimethylpentanoate.
| Compound Name | methyl 3-[2-amino-4-(methylcarbamoyl)anilino]-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 175140630 |
| Molecular Formula | C16H25N3O3 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | methyl 3-[2-amino-4-(methylcarbamoyl)anilino]-4,4-dimethylpentanoate |
| SMILES | CNC(=O)c1ccc(NC(CC(=O)OC)C(C)(C)C)c(N)c1 |
| InChI | InChI=1S/C16H25N3O3/c1-16(2,3)13(9-14(20)22-5)19-12-7-6-10(8-11(12)17)15(21)18-4/h6-8,13,19H,9,17H2,1-5H3,(H,18,21) |
| InChIKey | LDGNVQORMDFMAH-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|