C15H13N5 — CID 104714857
2-amino-3-(2-pyridin-3-ylethyl)benzimidazole-5-carbonitrile (PubChem CID 104714857) has the molecular formula C15H13N5 and a molecular weight of 263.30 g/mol. Its IUPAC name is 2-amino-3-(2-pyridin-3-ylethyl)benzimidazole-5-carbonitrile.
| Compound Name | 2-amino-3-(2-pyridin-3-ylethyl)benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 104714857 |
| Molecular Formula | C15H13N5 |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2-amino-3-(2-pyridin-3-ylethyl)benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2nc(N)n(CCc3cccnc3)c2c1 |
| InChI | InChI=1S/C15H13N5/c16-9-12-3-4-13-14(8-12)20(15(17)19-13)7-5-11-2-1-6-18-10-11/h1-4,6,8,10H,5,7H2,(H2,17,19) |
| InChIKey | HCLIICRQOCMEST-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 80.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |