C12H12N4O2 — CID 104714869
methyl 3-(2-amino-6-cyanobenzimidazol-1-yl)propanoate (PubChem CID 104714869) has the molecular formula C12H12N4O2 and a molecular weight of 244.25 g/mol. Its IUPAC name is methyl 3-(2-amino-6-cyanobenzimidazol-1-yl)propanoate.
| Compound Name | methyl 3-(2-amino-6-cyanobenzimidazol-1-yl)propanoate |
|---|---|
| PubChem CID | 104714869 |
| Molecular Formula | C12H12N4O2 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | methyl 3-(2-amino-6-cyanobenzimidazol-1-yl)propanoate |
| SMILES | COC(=O)CCn1c(N)nc2ccc(C#N)cc21 |
| InChI | InChI=1S/C12H12N4O2/c1-18-11(17)4-5-16-10-6-8(7-13)2-3-9(10)15-12(16)14/h2-3,6H,4-5H2,1H3,(H2,14,15) |
| InChIKey | BVLMMTHMEXFRES-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 93.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |