C16H11N5 — CID 104714998
2-amino-3-[4-(cyanomethyl)phenyl]benzimidazole-5-carbonitrile (PubChem CID 104714998) has the molecular formula C16H11N5 and a molecular weight of 273.30 g/mol. Its IUPAC name is 2-amino-3-[4-(cyanomethyl)phenyl]benzimidazole-5-carbonitrile.
| Compound Name | 2-amino-3-[4-(cyanomethyl)phenyl]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 104714998 |
| Molecular Formula | C16H11N5 |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2-amino-3-[4-(cyanomethyl)phenyl]benzimidazole-5-carbonitrile |
| SMILES | N#CCc1ccc(-n2c(N)nc3ccc(C#N)cc32)cc1 |
| InChI | InChI=1S/C16H11N5/c17-8-7-11-1-4-13(5-2-11)21-15-9-12(10-18)3-6-14(15)20-16(21)19/h1-6,9H,7H2,(H2,19,20) |
| InChIKey | VEXXKJWSQSBKJB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |