C20H15N5O — CID 171494383
2-(2-amino-3-pyridinyl)-3-[4-(hydroxymethyl)phenyl]benzimidazole-5-carbonitrile (PubChem CID 171494383) has the molecular formula C20H15N5O and a molecular weight of 341.37 g/mol. Its IUPAC name is 2-(2-amino-3-pyridinyl)-3-[4-(hydroxymethyl)phenyl]benzimidazole-5-carbonitrile.
| Compound Name | 2-(2-amino-3-pyridinyl)-3-[4-(hydroxymethyl)phenyl]benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 171494383 |
| Molecular Formula | C20H15N5O |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-(2-amino-3-pyridinyl)-3-[4-(hydroxymethyl)phenyl]benzimidazole-5-carbonitrile |
| SMILES | N#Cc1ccc2nc(-c3cccnc3N)n(-c3ccc(CO)cc3)c2c1 |
| InChI | InChI=1S/C20H15N5O/c21-11-14-5-8-17-18(10-14)25(15-6-3-13(12-26)4-7-15)20(24-17)16-2-1-9-23-19(16)22/h1-10,26H,12H2,(H2,22,23) |
| InChIKey | HGRLUDAWBKYSIY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |