C19H12N8O — CID 171599317
2-(2-amino-3-pyridinyl)-1-[4-(hydroxymethyl)phenyl]-5-isocyanoimidazo[4,5-b]pyrazine-6-carbonitrile (PubChem CID 171599317) has the molecular formula C19H12N8O and a molecular weight of 368.36 g/mol. Its IUPAC name is 2-(2-amino-3-pyridinyl)-1-[4-(hydroxymethyl)phenyl]-5-isocyanoimidazo[4,5-b]pyrazine-6-carbonitrile.
| Compound Name | 2-(2-amino-3-pyridinyl)-1-[4-(hydroxymethyl)phenyl]-5-isocyanoimidazo[4,5-b]pyrazine-6-carbonitrile |
|---|---|
| PubChem CID | 171599317 |
| Molecular Formula | C19H12N8O |
| Molecular Weight | 368.36 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-(2-amino-3-pyridinyl)-1-[4-(hydroxymethyl)phenyl]-5-isocyanoimidazo[4,5-b]pyrazine-6-carbonitrile |
| SMILES | [C-]#[N+]c1nc2nc(-c3cccnc3N)n(-c3ccc(CO)cc3)c2nc1C#N |
| InChI | InChI=1S/C19H12N8O/c1-22-16-14(9-20)24-19-17(25-16)26-18(13-3-2-8-23-15(13)21)27(19)12-6-4-11(10-28)5-7-12/h2-8,28H,10H2,(H2,21,23) |
| InChIKey | GBUICSDSDFVCTR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 130.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|