C20H19N5 — CID 170204603
3-[3-(4-propylphenyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine (PubChem CID 170204603) has the molecular formula C20H19N5 and a molecular weight of 329.41 g/mol. Its IUPAC name is 3-[3-(4-propylphenyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine.
| Compound Name | 3-[3-(4-propylphenyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 170204603 |
| Molecular Formula | C20H19N5 |
| Molecular Weight | 329.41 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 3-[3-(4-propylphenyl)imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
| SMILES | CCCc1ccc(-n2c(-c3cccnc3N)nc3cccnc32)cc1 |
| InChI | InChI=1S/C20H19N5/c1-2-5-14-8-10-15(11-9-14)25-19(16-6-3-12-22-18(16)21)24-17-7-4-13-23-20(17)25/h3-4,6-13H,2,5H2,1H3,(H2,21,22) |
| InChIKey | KCHNQGPIYYILJQ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.41 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |