C24H29N5OSi — CID 171601152
3-[3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine (PubChem CID 171601152) has the molecular formula C24H29N5OSi and a molecular weight of 431.62 g/mol. Its IUPAC name is 3-[3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine.
| Compound Name | 3-[3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 171601152 |
| Molecular Formula | C24H29N5OSi |
| Molecular Weight | 431.62 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 3-[3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]imidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(-n2c(-c3cccnc3N)nc3cccnc32)cc1 |
| InChI | InChI=1S/C24H29N5OSi/c1-24(2,3)31(4,5)30-16-17-10-12-18(13-11-17)29-22(19-8-6-14-26-21(19)25)28-20-9-7-15-27-23(20)29/h6-15H,16H2,1-5H3,(H2,25,26) |
| InChIKey | DOASNJYHLHGHSI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.62 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|