C26H29N5OSi — CID 171496183
3-[3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-ethynylimidazo[4,5-b]pyridin-2-yl]pyridin-2-amine (PubChem CID 171496183) has the molecular formula C26H29N5OSi and a molecular weight of 455.64 g/mol. Its IUPAC name is 3-[3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-ethynylimidazo[4,5-b]pyridin-2-yl]pyridin-2-amine.
| Compound Name | 3-[3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-ethynylimidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 171496183 |
| Molecular Formula | C26H29N5OSi |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | 3-[3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-5-ethynylimidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
| SMILES | C#Cc1ccc2nc(-c3cccnc3N)n(-c3ccc(CO[Si](C)(C)C(C)(C)C)cc3)c2n1 |
| InChI | InChI=1S/C26H29N5OSi/c1-7-19-12-15-22-25(29-19)31(24(30-22)21-9-8-16-28-23(21)27)20-13-10-18(11-14-20)17-32-33(5,6)26(2,3)4/h1,8-16H,17H2,2-6H3,(H2,27,28) |
| InChIKey | VSGVGCKUFZFJTG-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 78.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|