C21H23N7 — CID 58345308
3-[3-(4-tert-butylphenyl)-5-hydrazinylimidazo[4,5-b]pyridin-2-yl]pyridin-2-amine (PubChem CID 58345308) has the molecular formula C21H23N7 and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-[3-(4-tert-butylphenyl)-5-hydrazinylimidazo[4,5-b]pyridin-2-yl]pyridin-2-amine.
| Compound Name | 3-[3-(4-tert-butylphenyl)-5-hydrazinylimidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 58345308 |
| Molecular Formula | C21H23N7 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 3-[3-(4-tert-butylphenyl)-5-hydrazinylimidazo[4,5-b]pyridin-2-yl]pyridin-2-amine |
| SMILES | CC(C)(C)c1ccc(-n2c(-c3cccnc3N)nc3ccc(NN)nc32)cc1 |
| InChI | InChI=1S/C21H23N7/c1-21(2,3)13-6-8-14(9-7-13)28-19(15-5-4-12-24-18(15)22)25-16-10-11-17(27-23)26-20(16)28/h4-12H,23H2,1-3H3,(H2,22,24)(H,26,27) |
| InChIKey | GVZSMECTZILQCW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|