C19H17ClN6 — CID 171599395
2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]-N-(trideuteriomethyl)imidazo[4,5-b]pyridin-5-amine (PubChem CID 171599395) has the molecular formula C19H17ClN6 and a molecular weight of 367.86 g/mol. Its IUPAC name is 2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]-N-(trideuteriomethyl)imidazo[4,5-b]pyridin-5-amine.
| Compound Name | 2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]-N-(trideuteriomethyl)imidazo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 171599395 |
| Molecular Formula | C19H17ClN6 |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 2-(2-amino-3-pyridinyl)-3-[4-(chloromethyl)phenyl]-N-(trideuteriomethyl)imidazo[4,5-b]pyridin-5-amine |
| SMILES | [2H]C([2H])([2H])Nc1ccc2nc(-c3cccnc3N)n(-c3ccc(CCl)cc3)c2n1 |
| InChI | InChI=1S/C19H17ClN6/c1-22-16-9-8-15-19(25-16)26(13-6-4-12(11-20)5-7-13)18(24-15)14-3-2-10-23-17(14)21/h2-10H,11H2,1H3,(H2,21,23)(H,22,25)/i1D3 |
| InChIKey | XTTCEXQMWVCZNR-FIBGUPNXSA-N |
| XLogP | 3.85 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|